C21H21N3O6S — CID 26196881
ethyl 5-(dimethylcarbamoyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 26196881) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is ethyl 5-(dimethylcarbamoyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-(dimethylcarbamoyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 26196881 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | ethyl 5-(dimethylcarbamoyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)c3ccccc3C2=O)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C21H21N3O6S/c1-5-30-21(29)15-11(2)16(20(28)23(3)4)31-17(15)22-14(25)10-24-18(26)12-8-6-7-9-13(12)19(24)27/h6-9H,5,10H2,1-4H3,(H,22,25) |
| InChIKey | YLOAWIZIQSSCBP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|