C18H23NO7S — CID 2617231
dimethyl 5-[[2-(2-cyclopentylacetyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 2617231) has the molecular formula C18H23NO7S and a molecular weight of 397.45 g/mol. Its IUPAC name is dimethyl 5-[[2-(2-cyclopentylacetyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(2-cyclopentylacetyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2617231 |
| Molecular Formula | C18H23NO7S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | dimethyl 5-[[2-(2-cyclopentylacetyl)oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)COC(=O)CC2CCCC2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C18H23NO7S/c1-10-14(17(22)24-2)16(27-15(10)18(23)25-3)19-12(20)9-26-13(21)8-11-6-4-5-7-11/h11H,4-9H2,1-3H3,(H,19,20) |
| InChIKey | ZMZPPYRRSRYWHS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|