C17H19NO7S — CID 6386036
dimethyl 5-[[2-[(2E,4E)-hexa-2,4-dienoyl]oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 6386036) has the molecular formula C17H19NO7S and a molecular weight of 381.41 g/mol. Its IUPAC name is dimethyl 5-[[2-[(2E,4E)-hexa-2,4-dienoyl]oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[(2E,4E)-hexa-2,4-dienoyl]oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 6386036 |
| Molecular Formula | C17H19NO7S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | dimethyl 5-[[2-[(2E,4E)-hexa-2,4-dienoyl]oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | C/C=C/C=C/C(=O)OCC(=O)Nc1sc(C(=O)OC)c(C)c1C(=O)OC |
| InChI | InChI=1S/C17H19NO7S/c1-5-6-7-8-12(20)25-9-11(19)18-15-13(16(21)23-3)10(2)14(26-15)17(22)24-4/h5-8H,9H2,1-4H3,(H,18,19)/b6-5+,8-7+ |
| InChIKey | CTRJVHLQEVJNNF-BSWSSELBSA-N |
| XLogP | 2.24 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|