C23H24N2O7S — CID 3911654
dimethyl 5-[[2-[4-(1H-indol-3-yl)butanoyloxy]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 3911654) has the molecular formula C23H24N2O7S and a molecular weight of 472.52 g/mol. Its IUPAC name is dimethyl 5-[[2-[4-(1H-indol-3-yl)butanoyloxy]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[4-(1H-indol-3-yl)butanoyloxy]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3911654 |
| Molecular Formula | C23H24N2O7S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | dimethyl 5-[[2-[4-(1H-indol-3-yl)butanoyloxy]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)COC(=O)CCCc2c[nH]c3ccccc23)c(C(=O)OC)c1C |
| InChI | InChI=1S/C23H24N2O7S/c1-13-19(22(28)30-2)21(33-20(13)23(29)31-3)25-17(26)12-32-18(27)10-6-7-14-11-24-16-9-5-4-8-15(14)16/h4-5,8-9,11,24H,6-7,10,12H2,1-3H3,(H,25,26) |
| InChIKey | JANWPDQXPVSOLC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|