C12H14N2O3 — CID 39733476
2-[2-(2-hydroxyethylamino)ethyl]isoindole-1,3-dione (PubChem CID 39733476) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethylamino)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2-hydroxyethylamino)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 39733476 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-[2-(2-hydroxyethylamino)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCNCCO |
| InChI | InChI=1S/C12H14N2O3/c15-8-6-13-5-7-14-11(16)9-3-1-2-4-10(9)12(14)17/h1-4,13,15H,5-8H2 |
| InChIKey | WQSJERNHUMXCBI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|