C39H32N4O4 — CID 56668526
2-[2-[3-[2-(1,3-dioxophenanthro[9,10-c]pyrrol-2-yl)ethylamino]propylamino]ethyl]phenanthro[9,10-c]pyrrole-1,3-dione (PubChem CID 56668526) has the molecular formula C39H32N4O4 and a molecular weight of 620.71 g/mol. Its IUPAC name is 2-[2-[3-[2-(1,3-dioxophenanthro[9,10-c]pyrrol-2-yl)ethylamino]propylamino]ethyl]phenanthro[9,10-c]pyrrole-1,3-dione.
| Compound Name | 2-[2-[3-[2-(1,3-dioxophenanthro[9,10-c]pyrrol-2-yl)ethylamino]propylamino]ethyl]phenanthro[9,10-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 56668526 |
| Molecular Formula | C39H32N4O4 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | 2-[2-[3-[2-(1,3-dioxophenanthro[9,10-c]pyrrol-2-yl)ethylamino]propylamino]ethyl]phenanthro[9,10-c]pyrrole-1,3-dione |
| SMILES | O=C1c2c(c3ccccc3c3ccccc23)C(=O)N1CCNCCCNCCN1C(=O)c2c(c3ccccc3c3ccccc23)C1=O |
| InChI | InChI=1S/C39H32N4O4/c44-36-32-28-14-5-1-10-24(28)25-11-2-6-15-29(25)33(32)37(45)42(36)22-20-40-18-9-19-41-21-23-43-38(46)34-30-16-7-3-12-26(30)27-13-4-8-17-31(27)35(34)39(43)47/h1-8,10-17,40-41H,9,18-23H2 |
| InChIKey | LYQSAUKMBITSJQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|