C21H31NO5Si — CID 15817127
(2S,3R)-2-(1,3-dioxoisoindol-2-yl)-3-tri(propan-2-yl)silyloxybutanoic acid (PubChem CID 15817127) has the molecular formula C21H31NO5Si and a molecular weight of 405.57 g/mol. Its IUPAC name is (2S,3R)-2-(1,3-dioxoisoindol-2-yl)-3-tri(propan-2-yl)silyloxybutanoic acid.
| Compound Name | (2S,3R)-2-(1,3-dioxoisoindol-2-yl)-3-tri(propan-2-yl)silyloxybutanoic acid |
|---|---|
| PubChem CID | 15817127 |
| Molecular Formula | C21H31NO5Si |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | (2S,3R)-2-(1,3-dioxoisoindol-2-yl)-3-tri(propan-2-yl)silyloxybutanoic acid |
| SMILES | CC(C)[Si](O[C@H](C)[C@@H](C(=O)O)N1C(=O)c2ccccc2C1=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H31NO5Si/c1-12(2)28(13(3)4,14(5)6)27-15(7)18(21(25)26)22-19(23)16-10-8-9-11-17(16)20(22)24/h8-15,18H,1-7H3,(H,25,26)/t15-,18+/m1/s1 |
| InChIKey | SYZAZMMKLLEFMM-QAPCUYQASA-N |
| XLogP | 4.32 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|