C19H26N2O5 — CID 55348961
2-(1,3-dioxoisoindol-2-yl)-N,N-bis(2-methoxyethyl)-3-methylbutanamide (PubChem CID 55348961) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N,N-bis(2-methoxyethyl)-3-methylbutanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N,N-bis(2-methoxyethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 55348961 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N,N-bis(2-methoxyethyl)-3-methylbutanamide |
| SMILES | COCCN(CCOC)C(=O)C(C(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H26N2O5/c1-13(2)16(19(24)20(9-11-25-3)10-12-26-4)21-17(22)14-7-5-6-8-15(14)18(21)23/h5-8,13,16H,9-12H2,1-4H3 |
| InChIKey | IGXSTSGJOCKNTJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|