C25H36N2O3 — CID 78798058
N-[1-[benzyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide (PubChem CID 78798058) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is N-[1-[benzyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[1-[benzyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 78798058 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | N-[1-[benzyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide |
| SMILES | CC(C)C(NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C25H36N2O3/c1-17(2)22(23(29)27(8-9-28)16-18-6-4-3-5-7-18)26-24(30)25-13-19-10-20(14-25)12-21(11-19)15-25/h3-7,17,19-22,28H,8-16H2,1-2H3,(H,26,30) |
| InChIKey | CZUXZJIIVUJEHO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |