C27H32ClFN2O3S — CID 58624488
N-[1-(1-adamantyl)ethyl]-5-[benzyl(methyl)sulfamoyl]-2-chloro-4-fluorobenzamide (PubChem CID 58624488) has the molecular formula C27H32ClFN2O3S and a molecular weight of 519.08 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-5-[benzyl(methyl)sulfamoyl]-2-chloro-4-fluorobenzamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-5-[benzyl(methyl)sulfamoyl]-2-chloro-4-fluorobenzamide |
|---|---|
| PubChem CID | 58624488 |
| Molecular Formula | C27H32ClFN2O3S |
| Molecular Weight | 519.08 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-5-[benzyl(methyl)sulfamoyl]-2-chloro-4-fluorobenzamide |
| SMILES | CC(NC(=O)c1cc(S(=O)(=O)N(C)Cc2ccccc2)c(F)cc1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H32ClFN2O3S/c1-17(27-13-19-8-20(14-27)10-21(9-19)15-27)30-26(32)22-11-25(24(29)12-23(22)28)35(33,34)31(2)16-18-6-4-3-5-7-18/h3-7,11-12,17,19-21H,8-10,13-16H2,1-2H3,(H,30,32) |
| InChIKey | GHKCBHQAMBBJNZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.08 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |