C19H21ClN4O2 — CID 108520507
N-(1-benzylpiperidin-4-yl)-N'-(2-chloro-3-pyridinyl)oxamide (PubChem CID 108520507) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N'-(2-chloro-3-pyridinyl)oxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N'-(2-chloro-3-pyridinyl)oxamide |
|---|---|
| PubChem CID | 108520507 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N'-(2-chloro-3-pyridinyl)oxamide |
| SMILES | O=C(Nc1cccnc1Cl)C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H21ClN4O2/c20-17-16(7-4-10-21-17)23-19(26)18(25)22-15-8-11-24(12-9-15)13-14-5-2-1-3-6-14/h1-7,10,15H,8-9,11-13H2,(H,22,25)(H,23,26) |
| InChIKey | VZWUTLIVFNNMFU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|