C13H22N6O — CID 112946716
4-[5-[butyl(methyl)amino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde (PubChem CID 112946716) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-[5-[butyl(methyl)amino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[5-[butyl(methyl)amino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112946716 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 4-[5-[butyl(methyl)amino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde |
| SMILES | CCCCN(C)c1cnnc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C13H22N6O/c1-3-4-5-17(2)12-10-14-16-13(15-12)19-8-6-18(11-20)7-9-19/h10-11H,3-9H2,1-2H3 |
| InChIKey | QTJVIVIUTLQDNG-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|