C16H25N5O2 — CID 109326326
N-butyl-2-(4-formylpiperazin-1-yl)-N,6-dimethylpyrimidine-4-carboxamide (PubChem CID 109326326) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-butyl-2-(4-formylpiperazin-1-yl)-N,6-dimethylpyrimidine-4-carboxamide.
| Compound Name | N-butyl-2-(4-formylpiperazin-1-yl)-N,6-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109326326 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-butyl-2-(4-formylpiperazin-1-yl)-N,6-dimethylpyrimidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cc(C)nc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C16H25N5O2/c1-4-5-6-19(3)15(23)14-11-13(2)17-16(18-14)21-9-7-20(12-22)8-10-21/h11-12H,4-10H2,1-3H3 |
| InChIKey | OPCVKUCFASZPGX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|