C20H25N5O4 — CID 109326312
N-[(3,4-dimethoxyphenyl)methyl]-2-(4-formylpiperazin-1-yl)-6-methylpyrimidine-4-carboxamide (PubChem CID 109326312) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-(4-formylpiperazin-1-yl)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(4-formylpiperazin-1-yl)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109326312 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(4-formylpiperazin-1-yl)-6-methylpyrimidine-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cc(C)nc(N3CCN(C=O)CC3)n2)cc1OC |
| InChI | InChI=1S/C20H25N5O4/c1-14-10-16(23-20(22-14)25-8-6-24(13-26)7-9-25)19(27)21-12-15-4-5-17(28-2)18(11-15)29-3/h4-5,10-11,13H,6-9,12H2,1-3H3,(H,21,27) |
| InChIKey | ZADZVHNLOKPVLI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|