C17H23N3O5 — CID 108944709
N-[(3,4-dimethoxyphenyl)methyl]-3-(4-formylpiperazin-1-yl)-3-oxopropanamide (PubChem CID 108944709) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-3-(4-formylpiperazin-1-yl)-3-oxopropanamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-3-(4-formylpiperazin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108944709 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-3-(4-formylpiperazin-1-yl)-3-oxopropanamide |
| SMILES | COc1ccc(CNC(=O)CC(=O)N2CCN(C=O)CC2)cc1OC |
| InChI | InChI=1S/C17H23N3O5/c1-24-14-4-3-13(9-15(14)25-2)11-18-16(22)10-17(23)20-7-5-19(12-21)6-8-20/h3-4,9,12H,5-8,10-11H2,1-2H3,(H,18,22) |
| InChIKey | JLLRVIYHMZKFLI-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|