C17H28N4O — CID 112847027
6-(azepan-1-yl)-N-butyl-N,2-dimethylpyrimidine-4-carboxamide (PubChem CID 112847027) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 6-(azepan-1-yl)-N-butyl-N,2-dimethylpyrimidine-4-carboxamide.
| Compound Name | 6-(azepan-1-yl)-N-butyl-N,2-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112847027 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 6-(azepan-1-yl)-N-butyl-N,2-dimethylpyrimidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cc(N2CCCCCC2)nc(C)n1 |
| InChI | InChI=1S/C17H28N4O/c1-4-5-10-20(3)17(22)15-13-16(19-14(2)18-15)21-11-8-6-7-9-12-21/h13H,4-12H2,1-3H3 |
| InChIKey | RFKYYWHWQOTIRW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |