C16H28N4O — CID 112846701
N-butyl-N,2-dimethyl-6-(pentylamino)pyrimidine-4-carboxamide (PubChem CID 112846701) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is N-butyl-N,2-dimethyl-6-(pentylamino)pyrimidine-4-carboxamide.
| Compound Name | N-butyl-N,2-dimethyl-6-(pentylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112846701 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | N-butyl-N,2-dimethyl-6-(pentylamino)pyrimidine-4-carboxamide |
| SMILES | CCCCCNc1cc(C(=O)N(C)CCCC)nc(C)n1 |
| InChI | InChI=1S/C16H28N4O/c1-5-7-9-10-17-15-12-14(18-13(3)19-15)16(21)20(4)11-8-6-2/h12H,5-11H2,1-4H3,(H,17,18,19) |
| InChIKey | IWFHLKVRCQLRAG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|