C21H30N4O — CID 112847051
N-butyl-6-(4-tert-butylanilino)-N,2-dimethylpyrimidine-4-carboxamide (PubChem CID 112847051) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is N-butyl-6-(4-tert-butylanilino)-N,2-dimethylpyrimidine-4-carboxamide.
| Compound Name | N-butyl-6-(4-tert-butylanilino)-N,2-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112847051 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | N-butyl-6-(4-tert-butylanilino)-N,2-dimethylpyrimidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cc(Nc2ccc(C(C)(C)C)cc2)nc(C)n1 |
| InChI | InChI=1S/C21H30N4O/c1-7-8-13-25(6)20(26)18-14-19(23-15(2)22-18)24-17-11-9-16(10-12-17)21(3,4)5/h9-12,14H,7-8,13H2,1-6H3,(H,22,23,24) |
| InChIKey | BTKASYDVCYMNKA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |