C19H26N4O — CID 112847563
2-methyl-6-(4-methylanilino)-N,N-dipropylpyrimidine-4-carboxamide (PubChem CID 112847563) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-methyl-6-(4-methylanilino)-N,N-dipropylpyrimidine-4-carboxamide.
| Compound Name | 2-methyl-6-(4-methylanilino)-N,N-dipropylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112847563 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2-methyl-6-(4-methylanilino)-N,N-dipropylpyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(Nc2ccc(C)cc2)nc(C)n1 |
| InChI | InChI=1S/C19H26N4O/c1-5-11-23(12-6-2)19(24)17-13-18(21-15(4)20-17)22-16-9-7-14(3)8-10-16/h7-10,13H,5-6,11-12H2,1-4H3,(H,20,21,22) |
| InChIKey | ZLIIFUCCZBAHAJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |