C17H20Cl2N4O — CID 112847113
N-butyl-6-(2,5-dichloroanilino)-N,2-dimethylpyrimidine-4-carboxamide (PubChem CID 112847113) has the molecular formula C17H20Cl2N4O and a molecular weight of 367.28 g/mol. Its IUPAC name is N-butyl-6-(2,5-dichloroanilino)-N,2-dimethylpyrimidine-4-carboxamide.
| Compound Name | N-butyl-6-(2,5-dichloroanilino)-N,2-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112847113 |
| Molecular Formula | C17H20Cl2N4O |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-butyl-6-(2,5-dichloroanilino)-N,2-dimethylpyrimidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cc(Nc2cc(Cl)ccc2Cl)nc(C)n1 |
| InChI | InChI=1S/C17H20Cl2N4O/c1-4-5-8-23(3)17(24)15-10-16(21-11(2)20-15)22-14-9-12(18)6-7-13(14)19/h6-7,9-10H,4-5,8H2,1-3H3,(H,20,21,22) |
| InChIKey | UQZUAVVZKAUOQT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |