C19H24N4O — CID 112847677
6-(azepan-1-yl)-N,2-dimethyl-N-phenylpyrimidine-4-carboxamide (PubChem CID 112847677) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 6-(azepan-1-yl)-N,2-dimethyl-N-phenylpyrimidine-4-carboxamide.
| Compound Name | 6-(azepan-1-yl)-N,2-dimethyl-N-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112847677 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 6-(azepan-1-yl)-N,2-dimethyl-N-phenylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(C(=O)N(C)c2ccccc2)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C19H24N4O/c1-15-20-17(19(24)22(2)16-10-6-5-7-11-16)14-18(21-15)23-12-8-3-4-9-13-23/h5-7,10-11,14H,3-4,8-9,12-13H2,1-2H3 |
| InChIKey | SNVUHAFTSGOELQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |