C21H24N6 — CID 112949228
N-benzyl-N-methyl-3-(4-phenylpiperazin-1-yl)-1,2,4-triazin-5-amine (PubChem CID 112949228) has the molecular formula C21H24N6 and a molecular weight of 360.47 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-(4-phenylpiperazin-1-yl)-1,2,4-triazin-5-amine.
| Compound Name | N-benzyl-N-methyl-3-(4-phenylpiperazin-1-yl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112949228 |
| Molecular Formula | C21H24N6 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | N-benzyl-N-methyl-3-(4-phenylpiperazin-1-yl)-1,2,4-triazin-5-amine |
| SMILES | CN(Cc1ccccc1)c1cnnc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C21H24N6/c1-25(17-18-8-4-2-5-9-18)20-16-22-24-21(23-20)27-14-12-26(13-15-27)19-10-6-3-7-11-19/h2-11,16H,12-15,17H2,1H3 |
| InChIKey | DTBUZTOKYPXHGE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |