C19H26N6 — CID 112955538
1-[3-(4-phenylpiperazin-1-yl)-1,2,4-triazin-5-yl]azepane (PubChem CID 112955538) has the molecular formula C19H26N6 and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-[3-(4-phenylpiperazin-1-yl)-1,2,4-triazin-5-yl]azepane.
| Compound Name | 1-[3-(4-phenylpiperazin-1-yl)-1,2,4-triazin-5-yl]azepane |
|---|---|
| PubChem CID | 112955538 |
| Molecular Formula | C19H26N6 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1-[3-(4-phenylpiperazin-1-yl)-1,2,4-triazin-5-yl]azepane |
| SMILES | c1ccc(N2CCN(c3nncc(N4CCCCCC4)n3)CC2)cc1 |
| InChI | InChI=1S/C19H26N6/c1-2-7-11-24(10-6-1)18-16-20-22-19(21-18)25-14-12-23(13-15-25)17-8-4-3-5-9-17/h3-5,8-9,16H,1-2,6-7,10-15H2 |
| InChIKey | ISLKYQIVLKWOKY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |