C13H21N5 — CID 112941121
1-(5-pyrrolidin-1-yl-1,2,4-triazin-3-yl)azepane (PubChem CID 112941121) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is 1-(5-pyrrolidin-1-yl-1,2,4-triazin-3-yl)azepane.
| Compound Name | 1-(5-pyrrolidin-1-yl-1,2,4-triazin-3-yl)azepane |
|---|---|
| PubChem CID | 112941121 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 1-(5-pyrrolidin-1-yl-1,2,4-triazin-3-yl)azepane |
| SMILES | c1nnc(N2CCCCCC2)nc1N1CCCC1 |
| InChI | InChI=1S/C13H21N5/c1-2-4-10-18(9-3-1)13-15-12(11-14-16-13)17-7-5-6-8-17/h11H,1-10H2 |
| InChIKey | FTROXFJMJSVZQK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |