C16H21N5 — CID 112961359
3-(azepan-1-yl)-N-methyl-N-phenyl-1,2,4-triazin-5-amine (PubChem CID 112961359) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-(azepan-1-yl)-N-methyl-N-phenyl-1,2,4-triazin-5-amine.
| Compound Name | 3-(azepan-1-yl)-N-methyl-N-phenyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112961359 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 3-(azepan-1-yl)-N-methyl-N-phenyl-1,2,4-triazin-5-amine |
| SMILES | CN(c1ccccc1)c1cnnc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C16H21N5/c1-20(14-9-5-4-6-10-14)15-13-17-19-16(18-15)21-11-7-2-3-8-12-21/h4-6,9-10,13H,2-3,7-8,11-12H2,1H3 |
| InChIKey | PIUZGKBJTQYELA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |