C15H19N5O — CID 30298525
N-benzyl-N-methyl-3-morpholin-4-yl-1,2,4-triazin-5-amine (PubChem CID 30298525) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-morpholin-4-yl-1,2,4-triazin-5-amine.
| Compound Name | N-benzyl-N-methyl-3-morpholin-4-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 30298525 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-benzyl-N-methyl-3-morpholin-4-yl-1,2,4-triazin-5-amine |
| SMILES | CN(Cc1ccccc1)c1cnnc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H19N5O/c1-19(12-13-5-3-2-4-6-13)14-11-16-18-15(17-14)20-7-9-21-10-8-20/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | JEBAFVCXFTVLIT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |