C19H26N4O — CID 112912293
N-benzyl-6-methyl-2-morpholin-4-yl-N-propan-2-ylpyrimidin-4-amine (PubChem CID 112912293) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is N-benzyl-6-methyl-2-morpholin-4-yl-N-propan-2-ylpyrimidin-4-amine.
| Compound Name | N-benzyl-6-methyl-2-morpholin-4-yl-N-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112912293 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | N-benzyl-6-methyl-2-morpholin-4-yl-N-propan-2-ylpyrimidin-4-amine |
| SMILES | Cc1cc(N(Cc2ccccc2)C(C)C)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H26N4O/c1-15(2)23(14-17-7-5-4-6-8-17)18-13-16(3)20-19(21-18)22-9-11-24-12-10-22/h4-8,13,15H,9-12,14H2,1-3H3 |
| InChIKey | FGIDKJOUTUAMKG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |