C21H31N3 — CID 113379293
N-benzyl-4-[(tert-butylamino)methyl]-6-methyl-N-propan-2-ylpyridin-2-amine (PubChem CID 113379293) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is N-benzyl-4-[(tert-butylamino)methyl]-6-methyl-N-propan-2-ylpyridin-2-amine.
| Compound Name | N-benzyl-4-[(tert-butylamino)methyl]-6-methyl-N-propan-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 113379293 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | N-benzyl-4-[(tert-butylamino)methyl]-6-methyl-N-propan-2-ylpyridin-2-amine |
| SMILES | Cc1cc(CNC(C)(C)C)cc(N(Cc2ccccc2)C(C)C)n1 |
| InChI | InChI=1S/C21H31N3/c1-16(2)24(15-18-10-8-7-9-11-18)20-13-19(12-17(3)23-20)14-22-21(4,5)6/h7-13,16,22H,14-15H2,1-6H3 |
| InChIKey | CCSREWQRLULYPN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |