C15H17ClN6O — CID 112946667
4-[5-[(2-chlorophenyl)methylamino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde (PubChem CID 112946667) has the molecular formula C15H17ClN6O and a molecular weight of 332.80 g/mol. Its IUPAC name is 4-[5-[(2-chlorophenyl)methylamino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[5-[(2-chlorophenyl)methylamino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112946667 |
| Molecular Formula | C15H17ClN6O |
| Molecular Weight | 332.80 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-[5-[(2-chlorophenyl)methylamino]-1,2,4-triazin-3-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2nncc(NCc3ccccc3Cl)n2)CC1 |
| InChI | InChI=1S/C15H17ClN6O/c16-13-4-2-1-3-12(13)9-17-14-10-18-20-15(19-14)22-7-5-21(11-23)6-8-22/h1-4,10-11H,5-9H2,(H,17,19,20) |
| InChIKey | XAPAFKDUIFWXEW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.80 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|