C17H23N5O — CID 112944290
N-(4-tert-butylphenyl)-3-morpholin-4-yl-1,2,4-triazin-5-amine (PubChem CID 112944290) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3-morpholin-4-yl-1,2,4-triazin-5-amine.
| Compound Name | N-(4-tert-butylphenyl)-3-morpholin-4-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112944290 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-3-morpholin-4-yl-1,2,4-triazin-5-amine |
| SMILES | CC(C)(C)c1ccc(Nc2cnnc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C17H23N5O/c1-17(2,3)13-4-6-14(7-5-13)19-15-12-18-21-16(20-15)22-8-10-23-11-9-22/h4-7,12H,8-11H2,1-3H3,(H,19,20,21) |
| InChIKey | ADEWTKGBXGTRBQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |