C13H14FN5O — CID 30298452
N-(2-fluorophenyl)-3-morpholin-4-yl-1,2,4-triazin-5-amine (PubChem CID 30298452) has the molecular formula C13H14FN5O and a molecular weight of 275.29 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-morpholin-4-yl-1,2,4-triazin-5-amine.
| Compound Name | N-(2-fluorophenyl)-3-morpholin-4-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 30298452 |
| Molecular Formula | C13H14FN5O |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-(2-fluorophenyl)-3-morpholin-4-yl-1,2,4-triazin-5-amine |
| SMILES | Fc1ccccc1Nc1cnnc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H14FN5O/c14-10-3-1-2-4-11(10)16-12-9-15-18-13(17-12)19-5-7-20-8-6-19/h1-4,9H,5-8H2,(H,16,17,18) |
| InChIKey | DJQXGXYWVQGSHW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |