C19H29N7 — CID 112946118
4-N,4-N-diethyl-2-methyl-1-N-[3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-yl]benzene-1,4-diamine (PubChem CID 112946118) has the molecular formula C19H29N7 and a molecular weight of 355.49 g/mol. Its IUPAC name is 4-N,4-N-diethyl-2-methyl-1-N-[3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-yl]benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-2-methyl-1-N-[3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 112946118 |
| Molecular Formula | C19H29N7 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 4-N,4-N-diethyl-2-methyl-1-N-[3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-yl]benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2cnnc(N3CCN(C)CC3)n2)c(C)c1 |
| InChI | InChI=1S/C19H29N7/c1-5-25(6-2)16-7-8-17(15(3)13-16)21-18-14-20-23-19(22-18)26-11-9-24(4)10-12-26/h7-8,13-14H,5-6,9-12H2,1-4H3,(H,21,22,23) |
| InChIKey | PPNZRPSQTZIQED-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|