C22H25N7 — CID 112962724
3-(2,3-dihydroindol-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazin-5-amine (PubChem CID 112962724) has the molecular formula C22H25N7 and a molecular weight of 387.49 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazin-5-amine.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112962724 |
| Molecular Formula | C22H25N7 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,4-triazin-5-amine |
| SMILES | CN1CCN(c2ccc(Nc3cnnc(N4CCc5ccccc54)n3)cc2)CC1 |
| InChI | InChI=1S/C22H25N7/c1-27-12-14-28(15-13-27)19-8-6-18(7-9-19)24-21-16-23-26-22(25-21)29-11-10-17-4-2-3-5-20(17)29/h2-9,16H,10-15H2,1H3,(H,24,25,26) |
| InChIKey | UYOLENZRGMMRSF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|