C23H25N5 — CID 112877270
6-(2,3-dihydroindol-1-yl)-2-methyl-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-4-amine (PubChem CID 112877270) has the molecular formula C23H25N5 and a molecular weight of 371.49 g/mol. Its IUPAC name is 6-(2,3-dihydroindol-1-yl)-2-methyl-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-4-amine.
| Compound Name | 6-(2,3-dihydroindol-1-yl)-2-methyl-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112877270 |
| Molecular Formula | C23H25N5 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 6-(2,3-dihydroindol-1-yl)-2-methyl-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-4-amine |
| SMILES | Cc1nc(Nc2ccc(N3CCCC3)cc2)cc(N2CCc3ccccc32)n1 |
| InChI | InChI=1S/C23H25N5/c1-17-24-22(26-19-8-10-20(11-9-19)27-13-4-5-14-27)16-23(25-17)28-15-12-18-6-2-3-7-21(18)28/h2-3,6-11,16H,4-5,12-15H2,1H3,(H,24,25,26) |
| InChIKey | GWSZUDCPTVQQNS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|