C17H23N5O2 — CID 112942061
N-[2-(4-methoxyphenoxy)ethyl]-3-piperidin-1-yl-1,2,4-triazin-5-amine (PubChem CID 112942061) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-3-piperidin-1-yl-1,2,4-triazin-5-amine.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-3-piperidin-1-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112942061 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-3-piperidin-1-yl-1,2,4-triazin-5-amine |
| SMILES | COc1ccc(OCCNc2cnnc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C17H23N5O2/c1-23-14-5-7-15(8-6-14)24-12-9-18-16-13-19-21-17(20-16)22-10-3-2-4-11-22/h5-8,13H,2-4,9-12H2,1H3,(H,18,20,21) |
| InChIKey | SAMNFTIHYZOQNO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|