C23H26N4O2 — CID 112920435
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-(4-methoxyphenoxy)ethyl]-6-methylpyrimidin-4-amine (PubChem CID 112920435) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-(4-methoxyphenoxy)ethyl]-6-methylpyrimidin-4-amine.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-(4-methoxyphenoxy)ethyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112920435 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-(4-methoxyphenoxy)ethyl]-6-methylpyrimidin-4-amine |
| SMILES | COc1ccc(OCCNc2cc(C)nc(N3CCc4ccccc4C3)n2)cc1 |
| InChI | InChI=1S/C23H26N4O2/c1-17-15-22(24-12-14-29-21-9-7-20(28-2)8-10-21)26-23(25-17)27-13-11-18-5-3-4-6-19(18)16-27/h3-10,15H,11-14,16H2,1-2H3,(H,24,25,26) |
| InChIKey | OVDJLICJPQTMTO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|