C14H24N4O2S — CID 112867879
6-N-butyl-4-N-(1,1-dioxothiolan-3-yl)-4-N,2-dimethylpyrimidine-4,6-diamine (PubChem CID 112867879) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 6-N-butyl-4-N-(1,1-dioxothiolan-3-yl)-4-N,2-dimethylpyrimidine-4,6-diamine.
| Compound Name | 6-N-butyl-4-N-(1,1-dioxothiolan-3-yl)-4-N,2-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112867879 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 6-N-butyl-4-N-(1,1-dioxothiolan-3-yl)-4-N,2-dimethylpyrimidine-4,6-diamine |
| SMILES | CCCCNc1cc(N(C)C2CCS(=O)(=O)C2)nc(C)n1 |
| InChI | InChI=1S/C14H24N4O2S/c1-4-5-7-15-13-9-14(17-11(2)16-13)18(3)12-6-8-21(19,20)10-12/h9,12H,4-8,10H2,1-3H3,(H,15,16,17) |
| InChIKey | FCPHTCZMOZZIBC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|