C15H24N4O3S — CID 109361591
6-(butylamino)-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpyrimidine-4-carboxamide (PubChem CID 109361591) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is 6-(butylamino)-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpyrimidine-4-carboxamide.
| Compound Name | 6-(butylamino)-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109361591 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 6-(butylamino)-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpyrimidine-4-carboxamide |
| SMILES | CCCCNc1cc(C(=O)N(C)C2CCS(=O)(=O)C2)nc(C)n1 |
| InChI | InChI=1S/C15H24N4O3S/c1-4-5-7-16-14-9-13(17-11(2)18-14)15(20)19(3)12-6-8-23(21,22)10-12/h9,12H,4-8,10H2,1-3H3,(H,16,17,18) |
| InChIKey | GOKFODBSJKZOFK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|