C17H29N3O2S — CID 133367935
2,6-ditert-butyl-N-[(1,1-dioxothiolan-3-yl)methyl]pyrimidin-4-amine (PubChem CID 133367935) has the molecular formula C17H29N3O2S and a molecular weight of 339.51 g/mol. Its IUPAC name is 2,6-ditert-butyl-N-[(1,1-dioxothiolan-3-yl)methyl]pyrimidin-4-amine.
| Compound Name | 2,6-ditert-butyl-N-[(1,1-dioxothiolan-3-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133367935 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2,6-ditert-butyl-N-[(1,1-dioxothiolan-3-yl)methyl]pyrimidin-4-amine |
| SMILES | CC(C)(C)c1cc(NCC2CCS(=O)(=O)C2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C17H29N3O2S/c1-16(2,3)13-9-14(20-15(19-13)17(4,5)6)18-10-12-7-8-23(21,22)11-12/h9,12H,7-8,10-11H2,1-6H3,(H,18,19,20) |
| InChIKey | IMPKRVYIAGYINS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |