C14H25N3 — CID 62192687
2,6-ditert-butyl-N-ethylpyrimidin-4-amine (PubChem CID 62192687) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 2,6-ditert-butyl-N-ethylpyrimidin-4-amine.
| Compound Name | 2,6-ditert-butyl-N-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 62192687 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2,6-ditert-butyl-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1cc(C(C)(C)C)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H25N3/c1-8-15-11-9-10(13(2,3)4)16-12(17-11)14(5,6)7/h9H,8H2,1-7H3,(H,15,16,17) |
| InChIKey | UTTWDVWMMVOMTE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |