C18H32N4O — CID 133382599
N-[2-[(2,6-ditert-butylpyrimidin-4-yl)amino]ethyl]-2-methylpropanamide (PubChem CID 133382599) has the molecular formula C18H32N4O and a molecular weight of 320.48 g/mol. Its IUPAC name is N-[2-[(2,6-ditert-butylpyrimidin-4-yl)amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[(2,6-ditert-butylpyrimidin-4-yl)amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 133382599 |
| Molecular Formula | C18H32N4O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | N-[2-[(2,6-ditert-butylpyrimidin-4-yl)amino]ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCNc1cc(C(C)(C)C)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C18H32N4O/c1-12(2)15(23)20-10-9-19-14-11-13(17(3,4)5)21-16(22-14)18(6,7)8/h11-12H,9-10H2,1-8H3,(H,20,23)(H,19,21,22) |
| InChIKey | LWYMJRBJTVZUSM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|