C11H12ClN3O2S — CID 83077156
2-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-4-carbonitrile (PubChem CID 83077156) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is 2-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83077156 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 2-chloro-6-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(Cl)nc(NCC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C11H12ClN3O2S/c12-10-3-9(5-13)4-11(15-10)14-6-8-1-2-18(16,17)7-8/h3-4,8H,1-2,6-7H2,(H,14,15) |
| InChIKey | JTKPCAHCQLPTTA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|