C14H14Cl2N2O2S — CID 97335193
7,8-dichloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]quinolin-2-amine (PubChem CID 97335193) has the molecular formula C14H14Cl2N2O2S and a molecular weight of 345.25 g/mol. Its IUPAC name is 7,8-dichloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]quinolin-2-amine.
| Compound Name | 7,8-dichloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]quinolin-2-amine |
|---|---|
| PubChem CID | 97335193 |
| Molecular Formula | C14H14Cl2N2O2S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 7,8-dichloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]quinolin-2-amine |
| SMILES | O=S1(=O)CC[C@H](CNc2ccc3ccc(Cl)c(Cl)c3n2)C1 |
| InChI | InChI=1S/C14H14Cl2N2O2S/c15-11-3-1-10-2-4-12(18-14(10)13(11)16)17-7-9-5-6-21(19,20)8-9/h1-4,9H,5-8H2,(H,17,18)/t9-/m1/s1 |
| InChIKey | OCFDDOCCZDQULC-SECBINFHSA-N |
| XLogP | 3.39 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |