C9H15N5O2S — CID 80907896
N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyrimidin-4-amine (PubChem CID 80907896) has the molecular formula C9H15N5O2S and a molecular weight of 257.32 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80907896 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1nccc(NCC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C9H15N5O2S/c10-14-9-11-3-1-8(13-9)12-5-7-2-4-17(15,16)6-7/h1,3,7H,2,4-6,10H2,(H2,11,12,13,14) |
| InChIKey | ZBGBMYJECTVSPZ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|