C13H19NO3S — CID 51566844
N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-4-ethoxyaniline (PubChem CID 51566844) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-4-ethoxyaniline.
| Compound Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 51566844 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(NC[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H19NO3S/c1-2-17-13-5-3-12(4-6-13)14-9-11-7-8-18(15,16)10-11/h3-6,11,14H,2,7-10H2,1H3/t11-/m1/s1 |
| InChIKey | SFOFBVJUHLSHGY-LLVKDONJSA-N |
| XLogP | 1.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|