C17H28N2O2 — CID 63423124
ethyl 2-amino-5-(2,4,4-trimethylpentan-2-ylamino)benzoate (PubChem CID 63423124) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is ethyl 2-amino-5-(2,4,4-trimethylpentan-2-ylamino)benzoate.
| Compound Name | ethyl 2-amino-5-(2,4,4-trimethylpentan-2-ylamino)benzoate |
|---|---|
| PubChem CID | 63423124 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | ethyl 2-amino-5-(2,4,4-trimethylpentan-2-ylamino)benzoate |
| SMILES | CCOC(=O)c1cc(NC(C)(C)CC(C)(C)C)ccc1N |
| InChI | InChI=1S/C17H28N2O2/c1-7-21-15(20)13-10-12(8-9-14(13)18)19-17(5,6)11-16(2,3)4/h8-10,19H,7,11,18H2,1-6H3 |
| InChIKey | GRMSADRWDIYOKM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|