C14H22N4O — CID 61306295
2-amino-5-[(1-ethylpyrrolidin-3-yl)methylamino]benzamide (PubChem CID 61306295) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-amino-5-[(1-ethylpyrrolidin-3-yl)methylamino]benzamide.
| Compound Name | 2-amino-5-[(1-ethylpyrrolidin-3-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 61306295 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-amino-5-[(1-ethylpyrrolidin-3-yl)methylamino]benzamide |
| SMILES | CCN1CCC(CNc2ccc(N)c(C(N)=O)c2)C1 |
| InChI | InChI=1S/C14H22N4O/c1-2-18-6-5-10(9-18)8-17-11-3-4-13(15)12(7-11)14(16)19/h3-4,7,10,17H,2,5-6,8-9,15H2,1H3,(H2,16,19) |
| InChIKey | JZMHWAUCDNCTAQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|