C12H13N3O4S — CID 104717722
3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzonitrile (PubChem CID 104717722) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzonitrile.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 104717722 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzonitrile |
| SMILES | N#Cc1cccc(NCC2CCS(=O)(=O)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O4S/c13-6-10-2-1-3-11(12(10)15(16)17)14-7-9-4-5-20(18,19)8-9/h1-3,9,14H,4-5,7-8H2 |
| InChIKey | CAFNVQXIUCJOST-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|