C13H16FNO4S — CID 94020752
N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-5-fluoro-2-methoxybenzamide (PubChem CID 94020752) has the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. Its IUPAC name is N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-5-fluoro-2-methoxybenzamide.
| Compound Name | N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-5-fluoro-2-methoxybenzamide |
|---|---|
| PubChem CID | 94020752 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-5-fluoro-2-methoxybenzamide |
| SMILES | COc1ccc(F)cc1C(=O)NC[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16FNO4S/c1-19-12-3-2-10(14)6-11(12)13(16)15-7-9-4-5-20(17,18)8-9/h2-3,6,9H,4-5,7-8H2,1H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | DTGCTBWEXAHEEN-VIFPVBQESA-N |
| XLogP | 1.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |