C8H9BrF4N4O2S — CID 106294324
5-bromo-2-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-3-sulfonamide (PubChem CID 106294324) has the molecular formula C8H9BrF4N4O2S and a molecular weight of 381.15 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106294324 |
| Molecular Formula | C8H9BrF4N4O2S |
| Molecular Weight | 381.15 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)pyridine-3-sulfonamide |
| SMILES | NNc1ncc(Br)cc1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H9BrF4N4O2S/c9-4-1-5(6(17-14)15-2-4)20(18,19)16-3-8(12,13)7(10)11/h1-2,7,16H,3,14H2,(H,15,17) |
| InChIKey | AIRWNDXVTRNXKC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.15 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|